Triphenylmethanamine, 98%
cas: 5824-40-8 — see every product listed under this CAS number, including other names
Triphenylmethanamine, 98% (CAS 5824-40-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg, 5kg, 10kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A206030-10g |
| cas | 5824-40-8 |
| size | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 587.31 Pln | |
| Ambeed | 1kg | 1104.63 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 160.40 Pln | |
| Chemat | 500g | 595.20 Pln | |
| Chemat | 1kg | 1106.00 Pln | |
| Chemat | 5kg | 4747.20 Pln | |
| Chemat | 10kg | price on request | |
| BLDpharm | 25g | 208.84 Pln | |
| BLDpharm | 100g | 236.61 Pln | |
| BLDpharm | 500g | 630.91 Pln | |
| BLDpharm | 1kg | 1180.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Triphenylmethanamine (CAS 5824-40-8) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: triphenylmethanamine. InChIKey: BZVJOYBTLHNRDW-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | triphenylmethanamine |
| InChIKey | BZVJOYBTLHNRDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N |
Computed by PubChem (NCBI)
