CAS 61350-00-3 appears in our catalog under these names: N-(3-Chlorophenyl)picolinamide, 99+%, VU 0364770, VU0364770/ 99.66% (existing batch purity), VU0364770 99+%, VU 0364770, 99+%, 99+%. Offered by: Fluorochem, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 10mg, 50mg, 5mg, 25mg, 200mg, 1mg.
N-(3-chlorophenyl)pyridine-2-carboxamide (CAS 61350-00-3) is a chemical compound with the molecular formula C12H9ClN2O and a molecular weight of 232.66 g/mol. IUPAC name: N-(3-chlorophenyl)pyridine-2-carboxamide. InChIKey: SUYUTNCKIOLMAJ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | N-(3-chlorophenyl)pyridine-2-carboxamide |
| InChIKey | SUYUTNCKIOLMAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)