CAS 503065-67-6 appears in our catalog under these names: WAY-616296/ 99.53% (existing batch purity), WAY–616296, (Z)-5-(3-(Benzyloxy)Benzylidene)-2-Thioxoimidazolidin-4-One, 98%, 98%, WAY-616296, 97.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
(5Z)-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (CAS 503065-67-6) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: (5Z)-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one. InChIKey: ROVFVJUJKZFITG-GDNBJRDFSA-N.
| Molecular formula | C17H14N2O2S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (5Z)-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| InChIKey | ROVFVJUJKZFITG-GDNBJRDFSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=C\3/C(=O)NC(=S)N3 |
Computed by PubChem (NCBI)