CAS 211555-08-7 appears in our catalog under these names: WHI-P180/ 97.74% (existing batch purity), WHI–P180, WHI-P180, WHI-P180 98%, WHI-P180, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol (CAS 211555-08-7) is a chemical compound with the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. IUPAC name: 3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol. InChIKey: BNDYIYYKEIXHNK-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| InChIKey | BNDYIYYKEIXHNK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)O)OC |
Computed by PubChem (NCBI)