CAS 117739-40-9 appears in our catalog under these names: XX-650-23/ 97.01% (existing batch purity), XX–650–23, N-(4-Cyanophenyl)-3-hydroxy-2-naphthamide, XX-650-23 97%, XX-650-23. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
N-(4-cyanophenyl)-3-hydroxynaphthalene-2-carboxamide (CAS 117739-40-9) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: N-(4-cyanophenyl)-3-hydroxynaphthalene-2-carboxamide. InChIKey: DRBIYQSSEMTUJQ-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | N-(4-cyanophenyl)-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | DRBIYQSSEMTUJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=CC=C(C=C3)C#N)O |
Computed by PubChem (NCBI)