Products 1373764-75-0
CAS 1373764-75-0 appears in our catalog under these names: YH-306/ 97.87% (existing batch purity), YH–306, YH-306, YH-306, 98.34%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 10 mg.
2-(4-hydroxyphenyl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone (CAS 1373764-75-0) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone. InChIKey: WFTJZQLEQGPZBC-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone |
| InChIKey | WFTJZQLEQGPZBC-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C3=CC=CC=C3N2)C(=O)CC4=CC=C(C=C4)O |
Computed by PubChem (NCBI)