cas: 952616-39-6 — see every product listed under this CAS number, including other names
Z-1,3-Cis-Achc-OH, 97%, 97% (CAS 952616-39-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BDS-5g |
| cas | 952616-39-6 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1341.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 386.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 952616-39-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LTEORMGXUMWZCU-QWHCGFSZSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LTEORMGXUMWZCU-QWHCGFSZSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)