cas: 952616-39-6 — see every product listed under this CAS number, including other names
Z-1,3-cis-ACHC (1S,3R+1R,3S) (CAS 952616-39-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330565-250MG |
| cas | 952616-39-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 310.33 Pln |
| delivery time | 3-4 weeks |
|---|
Cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 952616-39-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LTEORMGXUMWZCU-QWHCGFSZSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LTEORMGXUMWZCU-QWHCGFSZSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)