CAS 952616-39-6 appears in our catalog under these names: Z-1,3-Cis-Achc-OH, 97%, (+/–)–cis–3–(Carbobenzoxyamino)cyclohexanecarboxylic Acid, (+/-)-cis-3-(Carbobenzoxyamino)cyclohexanecarboxylic Acid, >95.0%(T), Z-1,3-Cis-Achc-OH, 97%, 97%, Z-1,3-cis-ACHC (1S,3R+1R,3S), ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 200mg, 250mg.
Cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 952616-39-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LTEORMGXUMWZCU-QWHCGFSZSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1S,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LTEORMGXUMWZCU-QWHCGFSZSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)