Z-Asn-OH, 98%
cas: 2304-96-3 — see every product listed under this CAS number, including other names
Z-Asn-OH, 98% (CAS 2304-96-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03052-25G |
| cas | 2304-96-3 |
| size | 25g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 154.13 Pln | |
| Fluorochem | 500g | 508.17 Pln | |
| Fluorochem | 1kg | 966.34 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 2304-96-3) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-VIFPVBQESA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)