Z-Asn-OH, 99%, 99%
cas: 2304-96-3 — see every product listed under this CAS number, including other names
Z-Asn-OH, 99%, 99% (CAS 2304-96-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LZ5-5g |
| cas | 2304-96-3 |
| size | 5g |
| availability | 15000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 393.60 Pln | |
| Chemat | 1kg | 702.80 Pln | |
| Chemat | 5kg | 3777.60 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 2304-96-3) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-VIFPVBQESA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)