cas: 2304-96-3 — see every product listed under this CAS number, including other names
Z-Asn-OH, 99.74% (CAS 2304-96-3) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008233-500 g |
| cas | 2304-96-3 |
| size | 500 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 784.09 Pln | |
| MedChemExpress | 100 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.74% |
(2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 2304-96-3) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-VIFPVBQESA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)