Z-Leu-OSu, 95%
cas: 3397-35-1 — see every product listed under this CAS number, including other names
Z-Leu-OSu, 95% (CAS 3397-35-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A568398-1g |
| cas | 3397-35-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| Ambeed | 100g | 1210.31 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 25g | 414.32 Pln | |
| BLDpharm | 100g | 1297.35 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1247.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,5-dioxopyrrolidin-1-yl) (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate (CAS 3397-35-1) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 362.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate. InChIKey: YHZUOMRURVTBMO-AWEZNQCLSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | YHZUOMRURVTBMO-AWEZNQCLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
N-((Phenylmethoxy)carbonyl)-L-leucine 2,5-dioxo-1-pyrrolidinyl ester, N-[(Phenylmethoxy)carbonyl]-L-leucine 2,5-dioxo-1-pyrrolidinyl ester, Z-Leu-OSu, N-Cbz-L-leucine N-Succinimidyl Ester, Z-L-leucine-N-hydroxysuccinimide ester, Z-L-Leucine N-hydroxysuccinimide ester, Z-L-Leu-Osu, N-Carbobenzoxy-L-leucine N-Succinimidyl Ester, 2,5-dioxoazolidinyl (2S)-4-methyl-2-[(phenylmethoxy)carbonylamino]pentanoate, (S)-2,5-Dioxopyrrolidin-1-yl 2-(((benzyloxy)carbonyl)amino)-4-methylpentanoate