CAS 3674-06-4 appears in our catalog under these names: Boc–Phe–Osu, Boc-L-Phe-OSu, BOC-PHE-OSU, >=98.0%, BOC-Phe-OSU, 97%, 97%. Offered by: GLPBio, Iris Biotech, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 3674-06-4) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 362.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: NHUCANAMPJGMQL-ZDUSSCGKSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | NHUCANAMPJGMQL-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)