Products 2576508-03-5
CAS 2576508-03-5 is the registry number for Boc-L-Phe(4-NH-Poc)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 500mg, Get quote.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid (CAS 2576508-03-5) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid. InChIKey: XVKXVKVSLASFST-AWEZNQCLSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid |
| InChIKey | XVKXVKVSLASFST-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)NC(=O)OCC#C)C(=O)O |
Computed by PubChem (NCBI)