CAS 1217230-42-6 appears in our catalog under these names: O-Acetyl Psilocin Fumarate, >95% (HPLC), 4–acetoxy DMT (fumarate), 4-Acetoxy-N,N-dimethyltryptamine fumarate. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
(E)-but-2-enedioic acid;[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate (CAS 1217230-42-6) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 362.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate. InChIKey: QIJLOAPCCJQEEZ-WLHGVMLRSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate |
| InChIKey | QIJLOAPCCJQEEZ-WLHGVMLRSA-N |
| SMILES | CC(=O)OC1=CC=CC2=C1C(=CN2)CCN(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)