Products 1331669-80-7
CAS 1331669-80-7 appears in our catalog under these names: O–Acetyl Psilocin–d4 Fumarate, o-Acetyl psilocin-d4 fumarate. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(E)-but-2-enedioic acid;[3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate (CAS 1331669-80-7) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 366.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;[3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate. InChIKey: QIJLOAPCCJQEEZ-IORFDXRYSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;[3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] acetate |
| InChIKey | QIJLOAPCCJQEEZ-IORFDXRYSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)OC(=O)C)C([2H])([2H])N(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)