CAS 1415819-76-9 is the registry number for tert-Butyl 8-nitro-4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 8-nitro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CAS 1415819-76-9) is a chemical compound with the molecular formula C18H22N2O6 and a molecular weight of 362.4 g/mol. IUPAC name: tert-butyl 8-nitro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate. InChIKey: AIEPLKSQRLSAKW-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | tert-butyl 8-nitro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | AIEPLKSQRLSAKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C(O2)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)