Z-Phe-OH, 99.53%
cas: 1161-13-3 — see every product listed under this CAS number, including other names
Z-Phe-OH, 99.53% (CAS 1161-13-3) is a chemical reagent available from Chemat. Available pack sizes: 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011423-100 g |
| cas | 1161-13-3 |
| size | 100 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 333.62 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.53% |
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1161-13-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RRONHWAVOYADJL-HNNXBMFYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)