cas: 1161-13-3 — see every product listed under this CAS number, including other names
N-Benzyloxycarbonyl-L-phenylalanine, >98.0%(HPLC)(T) (CAS 1161-13-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0660-5G |
| cas | 1161-13-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 98.68 Pln | |
| TCI | 25g | 236.36 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1161-13-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RRONHWAVOYADJL-HNNXBMFYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)