Z-Phe-OH, 95%
cas: 1161-13-3 — see every product listed under this CAS number, including other names
Z-Phe-OH, 95% (CAS 1161-13-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg, 1g. Offered by: BLDpharm, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD8557-5g |
| cas | 1161-13-3 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 203.29 Pln | |
| BLDpharm | 100g | 253.27 Pln | |
| BLDpharm | 500g | 630.91 Pln | |
| BLDpharm | 1kg | 1180.72 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 102.06 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 476.93 Pln | |
| Fluorochem | 1kg | 851.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1161-13-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RRONHWAVOYADJL-HNNXBMFYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)