cas: 1161-13-3 — see every product listed under this CAS number, including other names
N-Cbz-L-Phenylalanine, 95%, 95% (CAS 1161-13-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146DG-5g |
| cas | 1161-13-3 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 107.60 Pln | |
| Chemat | 500g | 355.20 Pln | |
| Chemat | 1000g | 616.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1161-13-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RRONHWAVOYADJL-HNNXBMFYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)