cas: 1164-16-5 — see every product listed under this CAS number, including other names
Z-Tyr-OH, 98% (CAS 1164-16-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 250g. Offered by: BLDpharm, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD8562-1g |
| cas | 1164-16-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 169.96 Pln | |
| BLDpharm | 100g | 353.23 Pln | |
| BLDpharm | 500g | 1491.72 Pln | |
| BLDpharm | 1kg | 2902.34 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 331.15 Pln | |
| Fluorochem | 250g | 737.26 Pln | |
| Fluorochem | 500g | 1403.69 Pln | |
| Fluorochem | 1g | 102.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1164-16-5) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: MCRMUCXATQAAMN-HNNXBMFYSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | MCRMUCXATQAAMN-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)