cas: 4449-43-8 — see every product listed under this CAS number, including other names
alpha-Thymidine, ≥97%, ≥97% (CAS 4449-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEPR-100mg |
| cas | 4449-43-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 1192.40 Pln | |
| Chemat | 1g | 3683.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 4449-43-8) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: IQFYYKKMVGJFEH-RNJXMRFFSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-RNJXMRFFSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)