boc-beta-Homoalanine, 97%
cas: 158851-30-0 — see every product listed under this CAS number, including other names
boc-beta-Homoalanine, 97% (CAS 158851-30-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045384-250MG |
| cas | 158851-30-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 253.05 Pln | |
| Fluorochem | 25g | 476.93 Pln | |
| Fluorochem | 100g | 1528.65 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 158851-30-0) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-LURJTMIESA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-{[(tert-butoxy)carbonyl]amino}butanoic acid, (3S)-3-(((tert-butoxy)carbonyl)amino)butanoic acid, Boc-L-beta-homoalanine, (S)-3-((tert-Butoxycarbonyl)amino)butanoic acid, Boc-beta-HoAla-OH, (S)-N-Boc-3-aminobutyric acid, Boc-L-|A-homoalanine, Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (3S)-, (3S)-3-(tert-butoxycarbonylamino)butanoic acid, boc-ss-Homoalanine