CAS 15991-23-8 is the registry number for (R)-3-tert-Butoxycarbonylamino-butyric acid, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 15991-23-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)