CAS 158851-30-0 appears in our catalog under these names: Boc-L-beta-homoalanine, 97%, Boc–?–HoAla–OH, Boc-L-beta-HAla-OH, Boc-β-HoAla-OH 97%, Boc-L-beta-homoalanine, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg, 50g, 250g.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 158851-30-0) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-LURJTMIESA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)