cas: 165036-59-9 — see every product listed under this CAS number, including other names
cis-1-Benzyl-4-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 97%, 97% (CAS 165036-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQMP-100mg |
| cas | 165036-59-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 500mg | 429.20 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 5574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,4S)-1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid (CAS 165036-59-9) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: YCRKEXYTCFTDDC-NWDGAFQWSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | YCRKEXYTCFTDDC-NWDGAFQWSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@@H]1C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)