Products 474317-64-1

CAS 474317-64-1 is the registry number for 1-Benzyl-4-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid (CAS 474317-64-1) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: YCRKEXYTCFTDDC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO4
Molecular weight263.29 g/mol
IUPAC name1-benzyl-4-methoxycarbonylpyrrolidine-3-carboxylic acid
InChIKeyYCRKEXYTCFTDDC-UHFFFAOYSA-N
SMILESCOC(=O)C1CN(CC1C(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)