cas: 63216-49-9 — see every product listed under this CAS number, including other names
cis-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 97%, 97% (CAS 63216-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OF8-250mg |
| cas | 63216-49-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 500mg | 237.20 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1514.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 63216-49-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)