cas: 63216-49-9 — see every product listed under this CAS number, including other names
cis-2-(tert-Butoxycarbonylamino)cyclohexanecarboxylic acid, 98% (CAS 63216-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 334270010 |
| cas | 63216-49-9 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 498.90 Pln | |
| Thermo Scientific (Acros) | 5g | 2173.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 63216-49-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)