cas: 189512-01-4 — see every product listed under this CAS number, including other names
ethyl 2-(tert-butoxycarbonylamino)thiazole-4-carboxylate, 98%, 98% (CAS 189512-01-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AC51-100mg |
| cas | 189512-01-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 10g | 1192.40 Pln | |
| Chemat | 25g | 2882.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate (CAS 189512-01-4) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate. InChIKey: CSKBQHOSNPFIQC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate |
| InChIKey | CSKBQHOSNPFIQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)