CAS 1810070-23-5 is the registry number for Methyl 5-([(tert-butoxy)carbonyl](methyl)amino)-1,3-thiazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-2-carboxylate (CAS 1810070-23-5) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: methyl 5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-2-carboxylate. InChIKey: PLCZAJPVVKDLJR-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | methyl 5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-2-carboxylate |
| InChIKey | PLCZAJPVVKDLJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CN=C(S1)C(=O)OC |
Computed by PubChem (NCBI)