exo BCN-O-PNB 95%
cas: 1380006-72-3 — see every product listed under this CAS number, including other names
exo BCN-O-PNB 95% (CAS 1380006-72-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756521-25mg |
| cas | 1380006-72-3 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 409.31 Pln | |
| Ambeed | 50mg | 542.81 Pln | |
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2717.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A756521 |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate (CAS 1380006-72-3) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate. InChIKey: QXNXOXMDBLHIDB-XYPWUTKMSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate |
| InChIKey | QXNXOXMDBLHIDB-XYPWUTKMSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])CCC#C1 |
Computed by PubChem (NCBI)
Synonyms:
endo-BCN-O-PNB, exo BCN-O-PNB, endo-BCN-PNP-carbonate, endo BCN--PNB, BCN-OPNP, EXO-, ((1R,8S,9s)-bicyclo[6.1.0]non-4-yn-9-yl)methyl 4-nitrophenyl carbonate, rel-((1R,8S,9r)-Bicyclo[6.1.0]non-4-yn-9-yl)methyl (4-nitrophenyl) carbonate, rel-((1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-yl)methyl (4-nitrophenyl) carbonate, [(1R,8S,9R)-bicyclo[6.1.0]non-4-yn-9-yl]methyl 4-nitrophenyl carbonate, [(1R,8S,9S)-bicyclo[6.1.0]non-4-yn-9-yl]methyl 4-nitrophenyl carbonate