cas: 1019158-02-1 — see every product listed under this CAS number, including other names
iST2-1, 98% (CAS 1019158-02-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A709164-5g |
| cas | 1019158-02-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 28102.06 Pln | |
| AmBeed | 1g | 9411.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine (CAS 1019158-02-1) is a chemical compound with the molecular formula C22H22N2O4 and a molecular weight of 378.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine. InChIKey: RBVNERPDMZVXIP-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]pyrrolidine |
| InChIKey | RBVNERPDMZVXIP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCCN2CC3=CC=C(O3)C4=CC=CC=C4[N+](=O)[O-] |
Computed by PubChem (NCBI)