cas: 180323-49-3 — see every product listed under this CAS number, including other names
methyl (1S,3R)-3-aminocyclopentane-1-carboxylate hydrochloride, 97% (CAS 180323-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F874345-100MG |
| cas | 180323-49-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 10g | 1658.81 Pln | |
| Fluorochem | 25g | 3439.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 180323-49-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-RIHPBJNCSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)