CAS 489446-79-9 appears in our catalog under these names: (1R,3R)–Methyl 3–aminocyclopentanecarboxylate hydrochloride, Methyl (1R,3R)-3-aminocyclopentane-1-carboxylate hydrochloride, 95%, 95%, (1R,3R)-Methyl-3-aminocyclopentanecarboxylate hydrochloride, 97%, (1R,3R)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 489446-79-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-KGZKBUQUSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)