CAS 39986-86-2 appears in our catalog under these names: p–Hydroxy–5,6–dehydrokawain, p-Hydroxy-5,6-dehydrokawain/ 97.86% (existing batch purity), p-Hydroxy-5,6-dehydrokawain. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
6-[(E)-2-(4-hydroxyphenyl)ethenyl]-4-methoxypyran-2-one (CAS 39986-86-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 6-[(E)-2-(4-hydroxyphenyl)ethenyl]-4-methoxypyran-2-one. InChIKey: VWYHYOYHRIWSJU-QPJJXVBHSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 6-[(E)-2-(4-hydroxyphenyl)ethenyl]-4-methoxypyran-2-one |
| InChIKey | VWYHYOYHRIWSJU-QPJJXVBHSA-N |
| SMILES | COC1=CC(=O)OC(=C1)/C=C/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)