CAS 1000018-19-8 is the registry number for 2-Benzyl-1,2,6-thiadiazinane 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-benzyl-1,2,6-thiadiazinane 1,1-dioxide (CAS 1000018-19-8) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 2-benzyl-1,2,6-thiadiazinane 1,1-dioxide. InChIKey: JUFCSQWFQHSDDX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 2-benzyl-1,2,6-thiadiazinane 1,1-dioxide |
| InChIKey | JUFCSQWFQHSDDX-UHFFFAOYSA-N |
| SMILES | C1CNS(=O)(=O)N(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)