Products 1000018-19-8

CAS 1000018-19-8 is the registry number for 2-Benzyl-1,2,6-thiadiazinane 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-benzyl-1,2,6-thiadiazinane 1,1-dioxide (CAS 1000018-19-8) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 2-benzyl-1,2,6-thiadiazinane 1,1-dioxide. InChIKey: JUFCSQWFQHSDDX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O2S
Molecular weight226.30 g/mol
IUPAC name2-benzyl-1,2,6-thiadiazinane 1,1-dioxide
InChIKeyJUFCSQWFQHSDDX-UHFFFAOYSA-N
SMILESC1CNS(=O)(=O)N(C1)CC2=CC=CC=C2

Computed by PubChem (NCBI)