CAS 1000018-40-5 appears in our catalog under these names: 4-Methanesulfonyl-3-pyrrolidinoaniline, 95%, 4-Methanesulfonyl-3-pyrrolidinoaniline. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 500mg.
4-methylsulfonyl-3-pyrrolidin-1-ylaniline (CAS 1000018-40-5) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 4-methylsulfonyl-3-pyrrolidin-1-ylaniline. InChIKey: AMMYEUZBQIIWPL-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 4-methylsulfonyl-3-pyrrolidin-1-ylaniline |
| InChIKey | AMMYEUZBQIIWPL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)N)N2CCCC2 |
Computed by PubChem (NCBI)