Products 1000025-14-8
CAS 1000025-14-8 is the registry number for PHD2-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[5-(4-cyanophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 1000025-14-8) is a chemical compound with the molecular formula C15H11N3O4 and a molecular weight of 297.26 g/mol. IUPAC name: 2-[[5-(4-cyanophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: FUWDGRQRRUDDDA-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 2-[[5-(4-cyanophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | FUWDGRQRRUDDDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(N=C2)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)