CAS 1000578-08-4 appears in our catalog under these names: 2,4-Dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine, 95%, 2,4-Dichloro-5,6,7,8-tetrahydropyrido(3,4-d)pyrimidine, 95%, 2,4–Dichloro–5,6,7,8–tetrahydropyrido(3,4–d)pyrimidine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (CAS 1000578-08-4) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine. InChIKey: IPSIICUFLIHDCA-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| InChIKey | IPSIICUFLIHDCA-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)