CAS 184163-39-1 appears in our catalog under these names: 2-Chloro-4-hydrazinylbenzonitrile hydrochloride, 95%, 2–Chloro–4–hydrazinylbenzonitrile hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-chloro-4-hydrazinylbenzonitrile;hydrochloride (CAS 184163-39-1) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: 2-chloro-4-hydrazinylbenzonitrile;hydrochloride. InChIKey: HGFAAUDSQLSSNC-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2-chloro-4-hydrazinylbenzonitrile;hydrochloride |
| InChIKey | HGFAAUDSQLSSNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)Cl)C#N.Cl |
Computed by PubChem (NCBI)