CAS 1417287-56-9 is the registry number for (S)-2,4-Dichloro-6-methyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-2,4-dichloro-6-methyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine (CAS 1417287-56-9) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: (6S)-2,4-dichloro-6-methyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine. InChIKey: SMGBXBPXUMCVRQ-VKHMYHEASA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | (6S)-2,4-dichloro-6-methyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | SMGBXBPXUMCVRQ-VKHMYHEASA-N |
| SMILES | C[C@H]1CC2=C(N1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)