Products 1260669-81-5
CAS 1260669-81-5 is the registry number for 2,4-Dichloro-5,6,7,8-tetrahydro-pyrido(3,2-d)pyrimidine. Offered by: TRC. Available pack sizes: 250mg.
2,4-dichloro-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidine (CAS 1260669-81-5) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidine. InChIKey: SPXITQCDMMYFOG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidine |
| InChIKey | SPXITQCDMMYFOG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NC(=N2)Cl)Cl)NC1 |
Computed by PubChem (NCBI)