CAS 65783-10-0 is the registry number for 1-(3,4-Dichlorophenyl)guanidine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)guanidine (CAS 65783-10-0) is a chemical compound with the molecular formula C7H7Cl2N3 and a molecular weight of 204.05 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)guanidine. InChIKey: NNRSVGLUJAPMQD-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2N3 |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)guanidine |
| InChIKey | NNRSVGLUJAPMQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C(N)N)Cl)Cl |
Computed by PubChem (NCBI)