Products 1000698-69-0
CAS 1000698-69-0 is the registry number for tert-Butyl (2-amino-4,5-dichlorophenyl)carbamate, 97+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2-amino-4,5-dichlorophenyl)carbamate (CAS 1000698-69-0) is a chemical compound with the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.14 g/mol. IUPAC name: tert-butyl N-(2-amino-4,5-dichlorophenyl)carbamate. InChIKey: YXOAVPVMMQLKMV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4,5-dichlorophenyl)carbamate |
| InChIKey | YXOAVPVMMQLKMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1N)Cl)Cl |
Computed by PubChem (NCBI)