Products 2633071-66-4
CAS 2633071-66-4 is the registry number for Ethyl 4-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxylate;hydrochloride (CAS 2633071-66-4) is a chemical compound with the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.14 g/mol. IUPAC name: ethyl 4-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxylate;hydrochloride. InChIKey: GWQKHMPZESMVDX-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | ethyl 4-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxylate;hydrochloride |
| InChIKey | GWQKHMPZESMVDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(CCNC2)C(=C1)Cl.Cl |
Computed by PubChem (NCBI)