CAS 1286968-94-2 is the registry number for Ethyl 2-(6-Amino-2,3-dichlorobenzyl)glycine-13C2(Anagrelide Impurity A). Offered by: TRC. Available pack sizes: 10mg, 1mg.
Ethyl 2-[(6-amino-2,3-dichlorophenyl)methylamino]acetate (CAS 1286968-94-2) is a chemical compound with the molecular formula C11H14Cl2N2O2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 2-[(6-amino-2,3-dichlorophenyl)methylamino]acetate. InChIKey: GXKCDDOGWWCMAO-UFYQYTSASA-N.
| Molecular formula | C11H14Cl2N2O2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 2-[(6-amino-2,3-dichlorophenyl)methylamino]acetate |
| InChIKey | GXKCDDOGWWCMAO-UFYQYTSASA-N |
| SMILES | CCO[13C](=O)[13CH2]NCC1=C(C=CC(=C1Cl)Cl)N |
Computed by PubChem (NCBI)