Products 2080306-27-8
CAS 2080306-27-8 appears in our catalog under these names: FFN200 dihydrochloride, FFN 200 dihydrochloride, FFN200 (dihydrochloride), 99.2%, FFN200 (dihydrochloride), 99.0%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 10 mg, 5 mg, 1mg.
7-amino-4-(2-aminoethyl)chromen-2-one;dihydrochloride (CAS 2080306-27-8) is a chemical compound with the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.14 g/mol. IUPAC name: 7-amino-4-(2-aminoethyl)chromen-2-one;dihydrochloride. InChIKey: YNQXRSNAOWBGLD-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | 7-amino-4-(2-aminoethyl)chromen-2-one;dihydrochloride |
| InChIKey | YNQXRSNAOWBGLD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC(=O)C=C2CCN.Cl.Cl |
Computed by PubChem (NCBI)